| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:39:04 UTC |
|---|
| Update Date | 2025-03-21 17:58:17 UTC |
|---|
| HMDB ID | HMDB0303606 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00013351 |
|---|
| Name | Kaempferol 3-gentiobioside |
|---|
| Frequency | 335.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H30O16 |
|---|
| Molecular Mass | 610.1534 |
|---|
| SMILES | O=c1c(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
|---|
| InChI Key | BITPRCODIALMOV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid-3-o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsacetalsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyranones and derivativessecondary alcoholsvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharidesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundflavonoid-3-o-glycosidepyranoneoxaneprimary alcoholorganoheterocyclic compoundalcoholbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|