DeepMet

Record Information
HMDB Status	detected
Creation Date	2024-02-20 23:39:05 UTC
Update Date	2025-03-21 17:58:16 UTC
HMDB ID	HMDB0244304
Metabolite Identification
DeepMet ID	DMID00013363
Name	4-Nitrophenyl beta-D-glucopyranosiduronic acid
Frequency	335.2
Structure
Chemical Formula	C₁₂H₁₃NO₉
Molecular Mass	315.059
SMILES	O=C(O)C1OC(Oc2ccc([N+](=O)[O-])cc2)C(O)C(O)C1O
InChI Key	QSUILVWOWLUOEU-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic oxygen compounds
Class	organooxygen compounds
Subclass	carbohydrates and carbohydrate conjugates
Direct Parent	o-glucuronides
Geometric Descriptor	aromatic heteromonocyclic compounds
Alternative Parents	acetals beta hydroxy acids and derivatives carbonyl compounds carboxylic acids glucuronic acid derivatives hydrocarbon derivatives monocarboxylic acids and derivatives monosaccharides nitroaromatic compounds nitrobenzenes organic oxides organic oxoanionic compounds organic oxoazanium compounds organonitrogen compounds organopnictogen compounds oxacyclic compounds oxanes phenol ethers phenoxy compounds propargyl-type 1,3-dipolar organic compounds pyran carboxylic acids secondary alcohols
Substituents	phenol ether monocyclic benzene moiety carbonyl group carboxylic acid aromatic heteromonocyclic compound allyl-type 1,3-dipolar organic compound o-glucuronide monosaccharide carboxylic acid derivative pyran carboxylic acid organic nitro compound propargyl-type 1,3-dipolar organic compound 1-o-glucuronide beta-hydroxy acid organic oxide acetal c-nitro compound organonitrogen compound organopnictogen compound organic oxoazanium oxane organoheterocyclic compound nitrobenzene nitroaromatic compound alcohol pyran carboxylic acid or derivatives organic 1,3-dipolar compound hydroxy acid oxacycle monocarboxylic acid or derivatives pyran secondary alcohol hydrocarbon derivative benzenoid organic nitrogen compound phenoxy compound organic hyponitrite

Showing information for DMID00013363