| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:39:11 UTC |
|---|
| Update Date | 2025-03-21 17:58:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00013596 |
|---|
| Frequency | 328.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10O5 |
|---|
| Molecular Mass | 234.0528 |
|---|
| SMILES | Oc1cc(O)c(-c2ccc(O)c(O)c2)c(O)c1 |
|---|
| InChI Key | VFCROCAJMCEKFM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | phloroglucinols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesorganooxygen compounds |
|---|
| Substituents | phloroglucinol derivativearomatic homomonocyclic compoundmonocyclic benzene moietyorganic oxygen compound1-hydroxy-2-unsubstituted benzenoidhydrocarbon derivative1-hydroxy-4-unsubstituted benzenoidorganooxygen compound |
|---|
