Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:39:14 UTC |
---|
Update Date | 2025-03-21 17:58:20 UTC |
---|
HMDB ID | HMDB0247489 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00013720 |
---|
Name | N-Acetyl-S-(2-carbamoylethyl)-L-cysteine |
---|
Frequency | 324.7 |
---|
Structure | |
---|
Chemical Formula | C8H14N2O4S |
---|
Molecular Mass | 234.0674 |
---|
SMILES | CC(=O)NC(CSCCC(N)=O)C(=O)O |
---|
InChI Key | GGBCHNJZQQEQRX-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | n-acyl-alpha amino acids |
---|
Geometric Descriptor | aliphatic acyclic compounds |
---|
Alternative Parents | acetamidesalpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdialkylthioethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary carboxylic acid amidessulfenyl compounds |
---|
Substituents | primary carboxylic acid amidealiphatic acyclic compoundcarbonyl groupcarboxylic acidorganosulfur compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundacetamidesulfenyl compoundn-acyl-alpha-amino aciddialkylthioethercarboxamide groupsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundthioethercysteine or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|