| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:39:19 UTC |
|---|
| Update Date | 2025-03-21 17:58:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00013899 |
|---|
| Frequency | 319.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O8S |
|---|
| Molecular Mass | 266.0096 |
|---|
| SMILES | Cc1c(C(O)OS(=O)(=O)O)cc(O)c(O)c1O |
|---|
| InChI Key | QOQZEMUCXSQAOC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl sulfatesaromatic alcoholshydrocarbon derivativesmeta cresolsorganic oxidesorganooxygen compoundsortho cresolspara cresolssulfuric acid monoesterstoluenes |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietysulfuric acid monoesterorganic sulfuric acid or derivativespyrogallol derivativem-cresol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundp-cresolalkyl sulfateo-cresolsulfate-esterhydrocarbon derivativesulfuric acid estertolueneorganooxygen compound |
|---|
