| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:39:22 UTC |
|---|
| Update Date | 2025-03-21 17:58:22 UTC |
|---|
| HMDB ID | HMDB0134123 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00013988 |
|---|
| Name | (2Z)-2-(phenylmethylidene)octanoic acid |
|---|
| Frequency | 316.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20O2 |
|---|
| Molecular Mass | 232.1463 |
|---|
| SMILES | CCCCCCC(=Cc1ccccc1)C(=O)O |
|---|
| InChI Key | ONCYWMWZJKRKSB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativesbranched fatty acidscarbocyclic fatty acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmedium-chain fatty acidsmonocarboxylic acids and derivativesorganic oxidesunsaturated fatty acids |
|---|
| Substituents | fatty acylcarbocyclic fatty acidmonocyclic benzene moietycarbonyl groupcarboxylic acidfatty acidcarboxylic acid derivativebranched fatty acidaromatic homomonocyclic compoundunsaturated fatty acidcinnamic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativemedium-chain fatty acidbenzenoidorganooxygen compound |
|---|
