| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:39:25 UTC |
|---|
| Update Date | 2025-03-21 17:58:24 UTC |
|---|
| HMDB ID | HMDB0252850 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014112 |
|---|
| Name | Glycerophosphoserine |
|---|
| Frequency | 313.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H14NO8P |
|---|
| Molecular Mass | 259.0457 |
|---|
| SMILES | NC(COP(=O)(O)OCC(O)CO)C(=O)O |
|---|
| InChI Key | ZWZWYGMENQVNFU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerophospholipids |
|---|
| Subclass | glycerophosphoserines |
|---|
| Direct Parent | glycerophosphoserines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acidscarbonyl compoundscarboxylic acidsdialkyl phosphateshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminesprimary alcoholssecondary alcohols |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-amino acid or derivativescarboxylic acid derivativephosphoethanolamineorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholglycerophosphoserine1,2-diolalcoholdialkyl phosphatemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
