| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:39:26 UTC |
|---|
| Update Date | 2025-03-21 17:58:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014150 |
|---|
| Frequency | 312.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H21NO4 |
|---|
| Molecular Mass | 267.1471 |
|---|
| SMILES | COCCc1ccc(OCC(O)CNC(C)=O)cc1 |
|---|
| InChI Key | UFFVPVGEYUQNHV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl etherscarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietycarbonyl groupetheralkyl aryl ethercarboxamide groupcarboxylic acid derivativedialkyl etheraromatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativetyrosol derivativeorganic nitrogen compoundphenoxy compoundacetamideorganooxygen compound |
|---|
