| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:39:30 UTC |
|---|
| Update Date | 2025-03-21 17:58:26 UTC |
|---|
| HMDB ID | HMDB0012250 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014294 |
|---|
| Name | L-Aspartyl-4-phosphate |
|---|
| Frequency | 309.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H8NO7P |
|---|
| Molecular Mass | 213.0038 |
|---|
| SMILES | NC(CC(=O)OP(=O)(O)O)C(=O)O |
|---|
| InChI Key | IXZNKTPIYKDIGG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl monophosphatesalpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesmonoalkylaminesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidacyl monophosphatefatty acidorganic oxideorganic oxygen compoundaspartic acid or derivativesorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
