Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:39:30 UTC |
---|
Update Date | 2025-03-21 17:58:25 UTC |
---|
HMDB ID | HMDB0302564 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00014308 |
---|
Name | 3-O-Methylkaempferol |
---|
Frequency | 308.6 |
---|
Structure | |
---|
Chemical Formula | C16H12O6 |
---|
Molecular Mass | 300.0634 |
---|
SMILES | COc1c(-c2ccc(O)cc2)oc2cc(O)cc(O)c2c1=O |
---|
InChI Key | VJJZJBUCDWKPLC-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | o-methylated flavonoids |
---|
Direct Parent | 3-o-methylated flavonoids |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3-methoxychromones4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous acids |
---|
Substituents | monocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoid3-methoxyflavonoid-skeletonalkyl aryl ether3-methoxychromoneorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
---|