| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:39:30 UTC |
|---|
| Update Date | 2025-03-21 17:58:25 UTC |
|---|
| HMDB ID | HMDB0302564 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014308 |
|---|
| Name | 3-O-Methylkaempferol |
|---|
| Frequency | 308.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O6 |
|---|
| Molecular Mass | 300.0634 |
|---|
| SMILES | COc1c(-c2ccc(O)cc2)oc2cc(O)cc(O)c2c1=O |
|---|
| InChI Key | VJJZJBUCDWKPLC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 3-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3-methoxychromones4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | monocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoid3-methoxyflavonoid-skeletonalkyl aryl ether3-methoxychromoneorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|