| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:39:37 UTC |
|---|
| Update Date | 2025-03-21 17:58:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014580 |
|---|
| Frequency | 301.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12O5 |
|---|
| Molecular Mass | 236.0685 |
|---|
| SMILES | CC(C(=O)O)c1ccc(CC(=O)C(=O)O)cc1 |
|---|
| InChI Key | KHFODZZQEARHLB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpyruvic acid derivatives |
|---|
| Direct Parent | phenylpyruvic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesaromatic monoterpenoidscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmonocyclic monoterpenoidsorganic oxidesphenylpropanoic acids |
|---|
| Substituents | monoterpenoidcarbonyl groupmonocyclic monoterpenoidcarboxylic acidphenylpyruvate3-phenylpropanoic-acidp-cymenealpha-hydroxy ketonecarboxylic acid derivativeketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compound2-phenylpropanoic-acidketo acidalpha-keto aciddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compoundaromatic monoterpenoid |
|---|
