| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:39:38 UTC |
|---|
| Update Date | 2025-03-21 17:58:28 UTC |
|---|
| HMDB ID | HMDB0001043 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014616 |
|---|
| Name | Arachidonic acid |
|---|
| Frequency | 301.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H32O2 |
|---|
| Molecular Mass | 304.2402 |
|---|
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)O |
|---|
| InChI Key | YZXBAPSDXZZRGB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | long-chain fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsfatty acylshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesstraight chain fatty acids |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupstraight chain fatty acidlong-chain fatty acidcarboxylic acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|
