| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:39:39 UTC |
|---|
| Update Date | 2025-03-21 17:58:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014656 |
|---|
| Frequency | 300.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13NO4S |
|---|
| Molecular Mass | 315.0565 |
|---|
| SMILES | O=S(=O)(O)c1cccc2cccc(Nc3ccc(O)cc3)c12 |
|---|
| InChI Key | OHBINKMYGZPORO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-naphthalene sulfonates1-sulfo,2-unsubstituted aromatic compoundsarylsulfonic acids and derivativesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsorganosulfonic acidssecondary aminessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietyorganosulfonic acid1-hydroxy-2-unsubstituted benzenoidorganosulfur compound1-naphthalene sulfonic acid or derivatives1-naphthalene sulfonateorganic oxideorganonitrogen compoundorganopnictogen compound1-sulfo,2-unsubstituted aromatic compoundaromatic homopolycyclic compoundsecondary aminesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativesnaphthalene sulfonatephenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|