| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:39:42 UTC |
|---|
| Update Date | 2025-03-21 17:58:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014766 |
|---|
| Frequency | 297.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12O6 |
|---|
| Molecular Mass | 240.0634 |
|---|
| SMILES | COc1cc(CC(=O)C(=O)O)cc(OC)c1O |
|---|
| InChI Key | OSIRPBGXEVFDDH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpyruvic acid derivatives |
|---|
| Direct Parent | phenylpyruvic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha-hydroxy ketonesalpha-keto acids and derivativesanisolescarboxylic acidsdimethoxybenzeneshydrocarbon derivativesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylpropanoic acids |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acid3-phenylpropanoic-acidmethoxyphenolalkyl aryl etheralpha-hydroxy ketonecarboxylic acid derivativeketonedimethoxybenzeneorganic oxidealpha-keto acidphenylpyruvatemethoxybenzenearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundm-dimethoxybenzeneanisoleketo acidphenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
