| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:39:44 UTC |
|---|
| Update Date | 2025-03-21 17:58:30 UTC |
|---|
| HMDB ID | HMDB0135594 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014838 |
|---|
| Name | 1,3-bis(4-hydroxyphenyl)propan-1-one |
|---|
| Frequency | 295.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O3 |
|---|
| Molecular Mass | 242.0943 |
|---|
| SMILES | O=C(CCc1ccc(O)cc1)c1ccc(O)cc1 |
|---|
| InChI Key | VWDLIENPFMYSKA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | retro-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolretro-dihydrochalconephenylketoneketonebutyrophenonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|