Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:39:44 UTC |
---|
Update Date | 2025-03-21 17:58:30 UTC |
---|
HMDB ID | HMDB0135594 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00014838 |
---|
Name | 1,3-bis(4-hydroxyphenyl)propan-1-one |
---|
Frequency | 295.6 |
---|
Structure | |
---|
Chemical Formula | C15H14O3 |
---|
Molecular Mass | 242.0943 |
---|
SMILES | O=C(CCc1ccc(O)cc1)c1ccc(O)cc1 |
---|
InChI Key | VWDLIENPFMYSKA-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | linear 1,3-diarylpropanoids |
---|
Subclass | chalcones and dihydrochalcones |
---|
Direct Parent | retro-dihydrochalcones |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativesorganic oxidesorganooxygen compounds |
---|
Substituents | monocyclic benzene moietyaryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolretro-dihydrochalconephenylketoneketonebutyrophenonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketone |
---|