Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:39:44 UTC |
---|
Update Date | 2025-03-21 17:58:30 UTC |
---|
HMDB ID | HMDB0246876 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00014839 |
---|
Name | 5'-Amino-5'-deoxyadenosine |
---|
Frequency | 295.6 |
---|
Structure | |
---|
Chemical Formula | C10H14N6O3 |
---|
Molecular Mass | 266.1127 |
---|
SMILES | NCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
---|
InChI Key | GVSGUDGNTHCZHI-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | nucleosides, nucleotides, and analogues |
---|
Class | 5'-deoxyribonucleosides |
---|
Subclass | 5'-deoxyribonucleosides |
---|
Direct Parent | 5'-deoxyribonucleosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkylaminesmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
---|
Substituents | monosaccharideimidazopyrimidinepyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcohol5'-deoxyribonucleosideazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
---|