| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:39:44 UTC |
|---|
| Update Date | 2025-03-21 17:58:30 UTC |
|---|
| HMDB ID | HMDB0246876 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014839 |
|---|
| Name | 5'-Amino-5'-deoxyadenosine |
|---|
| Frequency | 295.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N6O3 |
|---|
| Molecular Mass | 266.1127 |
|---|
| SMILES | NCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
|---|
| InChI Key | GVSGUDGNTHCZHI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | 5'-deoxyribonucleosides |
|---|
| Subclass | 5'-deoxyribonucleosides |
|---|
| Direct Parent | 5'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkylaminesmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | monosaccharideimidazopyrimidinepyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcohol5'-deoxyribonucleosideazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
