| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:39:45 UTC |
|---|
| Update Date | 2025-03-21 17:58:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014858 |
|---|
| Frequency | 295.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H8O8S |
|---|
| Molecular Mass | 215.994 |
|---|
| SMILES | O=C(OS(=O)(=O)O)C(O)C(O)CO |
|---|
| InChI Key | XJDNFJNZXZBVGW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholaliphatic acyclic compoundsulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativesmonosaccharidecarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativesulfuric acid esterprimary alcoholorganooxygen compound |
|---|
