| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:39:45 UTC |
|---|
| Update Date | 2025-03-21 17:58:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00014884 |
|---|
| Frequency | 294.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H31NO8 |
|---|
| Molecular Mass | 461.205 |
|---|
| SMILES | COc1ccc2c3c1OC1C(OC4OC(CO)C(O)C(O)C4O)C=CC4C(C2)N(C)CCC341 |
|---|
| InChI Key | NQJIVPDFVAPUAE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersanisolesazacyclic compoundscoumaranshydrocarbon derivativesmonosaccharidesorganopnictogen compoundsoxacyclic compoundsoxanesphenanthrenes and derivativespiperidinesprimary alcoholssecondary alcoholstetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etherethermonosaccharidealkyl aryl ethersaccharideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholpiperidinetertiary amineorganoheterocyclic compoundcoumaranalcoholphenanthreneazacycletertiary aliphatic amineoxacycleorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
