| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:39:49 UTC |
|---|
| Update Date | 2025-03-21 17:58:31 UTC |
|---|
| HMDB ID | HMDB0245577 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015004 |
|---|
| Name | 3-(3,5-Di-tert-butyl-4-hydroxyphenyl)propionic acid |
|---|
| Frequency | 291.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H26O3 |
|---|
| Molecular Mass | 278.1882 |
|---|
| SMILES | CC(C)(C)c1cc(CCC(=O)O)cc(C(C)(C)C)c1O |
|---|
| InChI Key | WPMYUUITDBHVQZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenolsphenylpropanes |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidcarboxylic acid derivativephenylpropanearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
