| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:39:50 UTC |
|---|
| Update Date | 2025-03-21 17:58:32 UTC |
|---|
| HMDB ID | HMDB0248991 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015044 |
|---|
| Name | Benzilic acid |
|---|
| Frequency | 290.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O3 |
|---|
| Molecular Mass | 228.0786 |
|---|
| SMILES | O=C(O)C(O)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | UKXSKSHDVLQNKG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesaromatic alcoholscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | aromatic alcoholalcoholdiphenylmethanecarbonyl groupcarboxylic acidalpha-hydroxy acidhydroxy acidcarboxylic acid derivativearomatic homomonocyclic compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|
