| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:39:53 UTC |
|---|
| Update Date | 2025-03-21 17:58:33 UTC |
|---|
| HMDB ID | HMDB0248241 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015163 |
|---|
| Name | 2,3-Diphenylacrylic acid |
|---|
| Frequency | 287.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O2 |
|---|
| Molecular Mass | 224.0837 |
|---|
| SMILES | O=C(O)C(=Cc1ccccc1)c1ccccc1 |
|---|
| InChI Key | BIDDLDNGQCUOJQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboxylic acidscinnamic acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidcarboxylic acid derivativearomatic homomonocyclic compoundcinnamic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganooxygen compoundstilbene |
|---|
