| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:39:54 UTC |
|---|
| Update Date | 2025-03-21 17:58:34 UTC |
|---|
| HMDB ID | HMDB0011681 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015199 |
|---|
| Name | Inosine 2'-phosphate |
|---|
| Frequency | 445.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N4O8P |
|---|
| Molecular Mass | 348.0471 |
|---|
| SMILES | O=c1[nH]cnc2c1ncn2C1OC(CO)C(O)C1OP(=O)(O)O |
|---|
| InChI Key | PGZVUSPTYXQADT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonoalkyl phosphatesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactampentose phosphatepyrimidoneimidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhypoxanthinehydrocarbon derivativepurineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
