| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:39:55 UTC |
|---|
| Update Date | 2025-03-21 17:58:33 UTC |
|---|
| HMDB ID | HMDB0028921 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015236 |
|---|
| Name | Isoleucyl-Gamma-glutamate |
|---|
| Frequency | 286.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H21N3O4 |
|---|
| Molecular Mass | 259.1532 |
|---|
| SMILES | CCC(C)C(N)C(=O)NC(=O)CCC(N)C(=O)O |
|---|
| InChI Key | PFUZINYUQIJPNG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsbranched fatty acidscarbonyl compoundscarboxylic acidsdicarboximideshydrocarbon derivativesisoleucine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidglutamine or derivativesfatty acidcarboxylic acid imide, n-unsubstitutedorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideisoleucine or derivativesalpha-amino acid amidebranched fatty acidn-acyl-aminecarboxylic acid imidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
