| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:39:57 UTC |
|---|
| Update Date | 2025-03-21 17:58:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015320 |
|---|
| Frequency | 343.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N5O7P |
|---|
| Molecular Mass | 333.0474 |
|---|
| SMILES | Nc1nc2ncc(C(O)C(O)COP(=O)(O)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | MVDDTPKOEJUREO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsaromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | aromatic alcohollactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1,2-diolalcoholpterinazacycleheteroaromatic compoundorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
