| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:39:57 UTC |
|---|
| Update Date | 2025-03-21 17:58:34 UTC |
|---|
| HMDB ID | HMDB0240535 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015331 |
|---|
| Name | Iberin-N-acetyl-cysteine |
|---|
| Frequency | 283.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18N2O4S3 |
|---|
| Molecular Mass | 326.0429 |
|---|
| SMILES | CC(=O)NC(CSC(=S)NCCCS(C)=O)C(=O)O |
|---|
| InChI Key | RBVJIAJZFANPKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-acyl-alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acetamidesalpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdithiocarbamic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfenyl compoundssulfinyl compoundssulfoxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidorganosulfur compoundorganic oxidesulfinyl compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundacetamidesulfenyl compoundn-acyl-alpha-amino acidcarboxamide groupsecondary carboxylic acid amidedithiocarbamic acid estermonocarboxylic acid or derivativesorganic oxygen compoundcysteine or derivativessulfoxidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
