| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:40:02 UTC |
|---|
| Update Date | 2025-03-21 17:58:36 UTC |
|---|
| HMDB ID | HMDB0033557 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015488 |
|---|
| Name | (±)-6-Chlorotryptophan |
|---|
| Frequency | 280.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11ClN2O2 |
|---|
| Molecular Mass | 238.0509 |
|---|
| SMILES | NC(Cc1c[nH]c2cc(Cl)ccc12)C(=O)O |
|---|
| InChI Key | FICLVQOYKYBXFN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | carbonyl groupcarboxylic acidindoleorganochlorideorganohalogen compoundorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundaryl chlorideazacycleheteroaromatic compoundindole or derivativesaryl halidemonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
