| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:40:02 UTC |
|---|
| Update Date | 2025-03-21 17:58:36 UTC |
|---|
| HMDB ID | HMDB0248006 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015502 |
|---|
| Name | Adenosine 5'-phosphorothioate |
|---|
| Frequency | 501.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N5O6PS |
|---|
| Molecular Mass | 363.0402 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)S)C(O)C1O |
|---|
| InChI Key | UBCPYVAQZGCDJO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | purine ribonucleotides |
|---|
| Direct Parent | purine ribonucleoside monophosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | purine ribonucleoside monophosphatemonosaccharideimidazopyrimidinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
