| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:07 UTC |
|---|
| Update Date | 2025-03-21 17:58:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015649 |
|---|
| Frequency | 276.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O4 |
|---|
| Molecular Mass | 268.0736 |
|---|
| SMILES | c1c2c(cc3c1OCO3)-c1cc3c(cc1CC2)OCO3 |
|---|
| InChI Key | KDPOXAQMUVWAAH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsbenzodioxoleshydrocarbon derivativesnaphthalenesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | oxacyclephenanthrenenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compoundbenzodioxole |
|---|
