| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:40:07 UTC |
|---|
| Update Date | 2025-03-21 17:58:38 UTC |
|---|
| HMDB ID | HMDB0245680 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015655 |
|---|
| Name | 2-Deoxy-2,3-dehydro-n-acetyl-neuraminic acid |
|---|
| Frequency | 276.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17NO8 |
|---|
| Molecular Mass | 291.0954 |
|---|
| SMILES | CC(=O)NC1C(O)C=C(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | JINJZWSZQKHCIP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acid derivatives |
|---|
| Direct Parent | acetamides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidoxacyclesecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundacetamideorganooxygen compound |
|---|
