Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:40:10 UTC |
---|
Update Date | 2025-03-21 17:58:38 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00015777 |
---|
Frequency | 273.5 |
---|
Structure | |
---|
Chemical Formula | C7H12N2O5 |
---|
Molecular Mass | 204.0746 |
---|
SMILES | NC(=O)CCC(NC(=O)CO)C(=O)O |
---|
InChI Key | ZLHKICUWSCDAIF-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | glutamine and derivatives |
---|
Geometric Descriptor | aliphatic acyclic compounds |
---|
Alternative Parents | alcohols and polyolsalpha amino acidscarbonyl compoundscarboxylic acidsfatty acids and conjugatesfatty amideshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary carboxylic acid amidesshort-chain hydroxy acids and derivatives |
---|
Substituents | primary carboxylic acid amidefatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidglutamine or derivativesfatty amidefatty acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-acyl-alpha amino acid or derivativesalcoholn-acyl-alpha-amino acidcarboxamide groupsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|