| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:40:11 UTC |
|---|
| Update Date | 2025-03-21 17:58:39 UTC |
|---|
| HMDB ID | HMDB0034127 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015817 |
|---|
| Name | Prunetin |
|---|
| Frequency | 272.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O5 |
|---|
| Molecular Mass | 284.0685 |
|---|
| SMILES | COc1cc(O)c2c(=O)c(-c3ccc(O)cc3)coc2c1 |
|---|
| InChI Key | KQMVAGISDHMXJJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | o-methylated isoflavonoids |
|---|
| Direct Parent | 7-o-methylisoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesisoflavonoidsorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compound7-o-methylisoflavoneisoflavonebenzopyranheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyrananisolephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
