| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:12 UTC |
|---|
| Update Date | 2025-03-21 17:58:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015832 |
|---|
| Frequency | 272.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9BrN2O |
|---|
| Molecular Mass | 251.9898 |
|---|
| SMILES | NC(=O)Cc1c[nH]c2ccc(Br)cc12 |
|---|
| InChI Key | DVPBWLLOGOINDW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl bromidesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganobromidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidespyrroles |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupazacycleindoleheteroaromatic compoundcarboxamide groupcarboxylic acid derivativeorganohalogen compoundaryl halideorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganobromideorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaryl bromideorganooxygen compound |
|---|
