| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:40:12 UTC |
|---|
| Update Date | 2025-03-21 17:58:39 UTC |
|---|
| HMDB ID | HMDB0029141 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015840 |
|---|
| Name | Valyl-Gamma-glutamate |
|---|
| Frequency | 272.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19N3O4 |
|---|
| Molecular Mass | 245.1376 |
|---|
| SMILES | CC(C)C(N)C(=O)NC(=O)CCC(N)C(=O)O |
|---|
| InChI Key | RNVIUPLZMWAIQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsbranched fatty acidscarbonyl compoundscarboxylic acidsdicarboximideshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsvaline and derivatives |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidglutamine or derivativesfatty acidcarboxylic acid imide, n-unsubstitutedorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidealpha-amino acid amidevaline or derivativesbranched fatty acidn-acyl-aminecarboxylic acid imidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
