| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:16 UTC |
|---|
| Update Date | 2025-03-21 17:58:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00015981 |
|---|
| Frequency | 269.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8O5S |
|---|
| Molecular Mass | 240.0092 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc(O)c2ccccc12 |
|---|
| InChI Key | OMCKTVKRSZHVHJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsarylsulfateshydrocarbon derivativesorganic oxidesorganooxygen compoundssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterorganic sulfuric acid or derivatives1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundorganic oxideorganic oxygen compoundsulfate-esterhydrocarbon derivative1-naphtholarylsulfatesulfuric acid esterorganooxygen compound |
|---|