| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:17 UTC |
|---|
| Update Date | 2025-03-21 17:58:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016029 |
|---|
| Frequency | 268.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O |
|---|
| Molecular Mass | 202.1358 |
|---|
| SMILES | C=CC(=O)CCc1c(C)ccc(C)c1C |
|---|
| InChI Key | GZRYGVNNMKLLCY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsenoneshydrocarbon derivativesketonesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupalpha,beta-unsaturated ketoneketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundhydrocarbon derivativeacryloyl-grouporganooxygen compoundenone |
|---|