| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:17 UTC |
|---|
| Update Date | 2025-03-21 17:58:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016031 |
|---|
| Frequency | 268.7 |
|---|
| Structure | |
|---|
| Chemical Formula | CH5Cl2O9P3 |
|---|
| Molecular Mass | 323.8523 |
|---|
| SMILES | O=P(O)(O)OP(=O)(O)C(Cl)(Cl)P(=O)(O)O |
|---|
| InChI Key | FURQDEVVBKYECG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphonic acids and derivatives |
|---|
| Subclass | bisphosphonates |
|---|
| Direct Parent | bisphosphonates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chlorideshydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesorganochloridesorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundbisphosphonatealkyl chlorideorganochlorideorganohalogen compoundorganic oxideorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundalkyl halidehydrocarbon derivativeorganic phosphoric acid derivative |
|---|