| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:18 UTC |
|---|
| Update Date | 2025-03-21 17:58:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016068 |
|---|
| Frequency | 267.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H8O8S |
|---|
| Molecular Mass | 227.994 |
|---|
| SMILES | O=C(O)CCC(OS(=O)(=O)O)C(=O)O |
|---|
| InChI Key | UKKNBRYDBUDPJQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | sulfated fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesshort-chain hydroxy acids and derivativessulfuric acid monoesters |
|---|
| Substituents | aliphatic acyclic compoundsulfuric acid monoestercarbonyl groupcarboxylic acidorganic sulfuric acid or derivativesshort-chain hydroxy acidcarboxylic acid derivativeorganic oxideorganic oxygen compoundsulfated fatty acidalkyl sulfatedicarboxylic acid or derivativessulfate-esterhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|
