| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:21 UTC |
|---|
| Update Date | 2025-03-21 17:58:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016158 |
|---|
| Frequency | 265.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11NO3 |
|---|
| Molecular Mass | 193.0739 |
|---|
| SMILES | OCCc1c[nH]c2cc(O)c(O)cc12 |
|---|
| InChI Key | OJPXHEHCWGSTJX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalcohols and polyolsazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | alcoholazacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
