| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:25 UTC |
|---|
| Update Date | 2025-03-21 17:58:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016300 |
|---|
| Frequency | 262.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H33FN2O2 |
|---|
| Molecular Mass | 460.2526 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(F)cc2)CC1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | CMGOLQAUWHFUES-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesfluorobenzeneshydrocarbon derivativesn-acyl aminesorganic oxidesorganofluoridesorganopnictogen compoundsphenylacetamidesphenylpiperidinestertiary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | aryl fluoridediphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganohalogen compoundfluorobenzeneorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundalcoholazacycleorganofluoridetertiary aliphatic aminecarboxamide groupn-acyl-aminearyl halidetertiary alcoholorganic oxygen compoundphenylpiperidinehydrocarbon derivativeorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
