| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:26 UTC |
|---|
| Update Date | 2025-03-21 17:58:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016337 |
|---|
| Frequency | 261.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H19NO4 |
|---|
| Molecular Mass | 289.1314 |
|---|
| SMILES | CN1C2CC(OC(=O)C(O)c3ccccc3)CC1C1OC12 |
|---|
| InChI Key | XQJJPBSYRSUEAM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxazinanes |
|---|
| Subclass | morpholines |
|---|
| Direct Parent | morpholines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaromatic alcoholsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersdialkyl ethersepoxideshydrocarbon derivativesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsoxacyclic compoundspiperidinessecondary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietycarbonyl groupetheramino acid or derivativescarboxylic acid derivativedialkyl etherorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidinepiperidinetertiary aminealcoholazacyclen-alkylpyrrolidinetertiary aliphatic amineoxiraneoxacyclemorpholinemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
