| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:40:26 UTC |
|---|
| Update Date | 2025-03-21 17:58:44 UTC |
|---|
| HMDB ID | HMDB0059927 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016347 |
|---|
| Name | 2-Hydroxy-2-(2-oxopropyl)butanedioic acid |
|---|
| Frequency | 261.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O6 |
|---|
| Molecular Mass | 190.0477 |
|---|
| SMILES | CC(=O)CC(O)(CC(=O)O)C(=O)O |
|---|
| InChI Key | FBBVDCTXVFGXRW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | medium-chain keto acids and derivatives |
|---|
| Direct Parent | medium-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta-hydroxy ketonesbranched fatty acidscarboxylic acidsdicarboxylic acids and derivativesfatty acylsgamma-keto acids and derivativeshydrocarbon derivativeshydroxy fatty acidsorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholfatty acylbeta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidhydroxy acidcarboxylic acid derivativebranched fatty acidgamma-keto acidketonetertiary alcoholorganic oxideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativehydroxy fatty acidorganooxygen compoundmedium-chain keto acid |
|---|
