| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:29 UTC |
|---|
| Update Date | 2025-03-21 17:58:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016442 |
|---|
| Frequency | 259.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H11N7 |
|---|
| Molecular Mass | 253.1076 |
|---|
| SMILES | Nc1nc(N)c2nc(N)c(-c3ccccc3)nc2n1 |
|---|
| InChI Key | YZCSSBFYANTMGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrazinespyrimidines and pyrimidine derivatives |
|---|
| Substituents | monocyclic benzene moietyazacycleheteroaromatic compoundpteridinepyrimidinearomatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundimidolactamamine |
|---|
