| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:33 UTC |
|---|
| Update Date | 2025-03-21 17:58:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016588 |
|---|
| Frequency | 257.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6O9S |
|---|
| Molecular Mass | 265.9733 |
|---|
| SMILES | O=C(OS(=O)(=O)O)c1cc(O)c(O)c(O)c1O |
|---|
| InChI Key | NKJZTJNQTFWAQN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | quinone and hydroquinone lipids |
|---|
| Direct Parent | ubiquinols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-unsubstituted pyrrogallolsbenzoic acids and derivativesbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundssalicylic acid and derivativessulfuric acid monoestersvinylogous acids |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterorganic sulfuric acid or derivativesbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativesubiquinol skeleton1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundvinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivatives5-unsubstituted pyrrogallolphenolhydrocarbon derivativebenzenoidsulfuric acid esterorganooxygen compound |
|---|
