Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:40:36 UTC |
---|
Update Date | 2025-03-21 17:58:46 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00016666 |
---|
Frequency | 255.8 |
---|
Structure | |
---|
Chemical Formula | C12H13NO5 |
---|
Molecular Mass | 251.0794 |
---|
SMILES | Cc1ccccc1C(=O)NC(CC(=O)O)C(=O)O |
---|
InChI Key | RFMCFOUAFSLXHP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | aspartic acid and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsbenzoyl derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshippuric acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amideso-toluamides |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidbenzoyltoluamidebenzamideorganic oxideo-toluamideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-acyl-alpha amino acid or derivativesn-acyl-alpha-amino acidhippuric acid or derivativesbenzoic acid or derivativescarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundaspartic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundtolueneorganooxygen compound |
---|