| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:36 UTC |
|---|
| Update Date | 2025-03-21 17:58:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016680 |
|---|
| Frequency | 255.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O4S |
|---|
| Molecular Mass | 274.03 |
|---|
| SMILES | O=S(=O)(O)Oc1cccc2ccc3ccccc3c12 |
|---|
| InChI Key | NGHHMZVUHHGUQB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | arylsulfateshydrocarbon derivativesnaphthalenesorganic oxidesorganooxygen compoundssulfuric acid monoesters |
|---|
| Substituents | phenanthrenesulfuric acid monoesterorganic sulfuric acid or derivativesaromatic homopolycyclic compoundorganic oxidenaphthaleneorganic oxygen compoundsulfate-esterhydrocarbon derivativearylsulfatesulfuric acid esterorganooxygen compound |
|---|
