| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:40 UTC |
|---|
| Update Date | 2025-03-21 17:58:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00016808 |
|---|
| Frequency | 253.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9O6P |
|---|
| Molecular Mass | 244.0137 |
|---|
| SMILES | O=C(O)C=Cc1ccc(OP(=O)(O)O)cc1 |
|---|
| InChI Key | YHJCTVKDEJINEY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenyl phosphates |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidphenyl phosphatecarboxylic acid derivativearomatic homomonocyclic compoundcinnamic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterhydrocarbon derivativearyl phosphomonoesterbenzenoidphenoxy compoundaryl phosphateorganic phosphoric acid derivativeorganooxygen compound |
|---|
