Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:40:46 UTC |
---|
Update Date | 2025-03-21 17:58:50 UTC |
---|
HMDB ID | HMDB0134549 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00017058 |
---|
Name | 3-hydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
---|
Frequency | 248.6 |
---|
Structure | |
---|
Chemical Formula | C15H10O4 |
---|
Molecular Mass | 254.0579 |
---|
SMILES | O=c1c(O)c(-c2ccc(O)cc2)oc2ccccc12 |
---|
InChI Key | GPGOCTLAUAHUQO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | flavones |
---|
Direct Parent | flavonols |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids3-hydroxyflavonoids4'-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
---|
Substituents | 3-hydroxyflavonemonocyclic benzene moiety3-hydroxyflavonoidbenzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranone4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
---|