| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:40:50 UTC |
|---|
| Update Date | 2025-03-21 17:58:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00017173 |
|---|
| Frequency | 246.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19N7O5 |
|---|
| Molecular Mass | 401.1448 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)NCC(CNc1ccc(C(=O)NC(CO)C(=O)O)cc1)=N2 |
|---|
| InChI Key | LINBWUAFXNNABG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | hippuric acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsazacyclic compoundsbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesketiminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary alcoholsprimary aminespropargyl-type 1,3-dipolar organic compoundspterins and derivativespyrimidonessecondary alkylarylaminessecondary carboxylic acid amidesserine and derivativesvinylogous amides |
|---|
| Substituents | carboxylic acidamino acid or derivativesbenzoylalpha-amino acid or derivativespteridinebeta-hydroxy acidorganonitrogen compoundalpha-amino acidorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesalcoholvinylogous amidepterinazacyclen-acyl-alpha-amino acidheteroaromatic compoundorganic 1,3-dipolar compoundsecondary aliphatic/aromatic aminesecondary carboxylic acid amidehydrocarbon derivativeprimary amineamineketiminecarbonyl groupamino acidiminepyrimidonecarboxylic acid derivativepyrimidinepropargyl-type 1,3-dipolar organic compoundorganic oxidearomatic heteropolycyclic compoundorganopnictogen compoundprimary alcoholhippuric acid or derivativeshydroxy acidsecondary aminecarboxamide groupmonocarboxylic acid or derivativesorganic oxygen compoundphenylalkylamineorganic nitrogen compoundserine or derivativesorganooxygen compound |
|---|