Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:40:53 UTC |
---|
Update Date | 2025-03-21 17:58:52 UTC |
---|
HMDB ID | HMDB0061117 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00017297 |
---|
Name | 3-(3,5-dihydroxyphenyl)-1-propanoic acid sulphate |
---|
Frequency | 244.3 |
---|
Structure | |
---|
Chemical Formula | C9H10O7S |
---|
Molecular Mass | 262.0147 |
---|
SMILES | O=C(CCc1cc(O)cc(O)c1)OS(=O)(=O)O |
---|
InChI Key | IZEZNNYKKNVXNA-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | phenols |
---|
Subclass | benzenediols |
---|
Direct Parent | resorcinols |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivatives1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativeresorcinolaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativesulfuric acid esterorganooxygen compound |
---|