| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:40:57 UTC |
|---|
| Update Date | 2025-03-21 17:58:54 UTC |
|---|
| HMDB ID | HMDB0254615 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00017437 |
|---|
| Name | Methyl syringate |
|---|
| Frequency | 242.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12O5 |
|---|
| Molecular Mass | 212.0685 |
|---|
| SMILES | COC(=O)c1cc(OC)c(O)c(OC)c1 |
|---|
| InChI Key | ZMXJAEGJWHJMGX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-methoxybenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesbenzoyl derivativesdimethoxybenzeneshydrocarbon derivativesmethoxyphenolsmethyl estersmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsp-hydroxybenzoic acid alkyl esters |
|---|
| Substituents | phenol etheretherp-hydroxybenzoic acid esterbenzoylmethoxyphenolbenzoate esteralkyl aryl ethercarboxylic acid derivativedimethoxybenzeneorganic oxidemethyl esterm-methoxybenzoic acid or derivativesmethoxybenzenep-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundm-dimethoxybenzeneanisolecarboxylic acid esterphenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
